C13H15N3O5S2 — CID 39861071
N-[5-[(2,4-dimethoxyphenyl)sulfamoyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 39861071) has the molecular formula C13H15N3O5S2 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[5-[(2,4-dimethoxyphenyl)sulfamoyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[(2,4-dimethoxyphenyl)sulfamoyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 39861071 |
| Molecular Formula | C13H15N3O5S2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | N-[5-[(2,4-dimethoxyphenyl)sulfamoyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cnc(NC(C)=O)s2)c(OC)c1 |
| InChI | InChI=1S/C13H15N3O5S2/c1-8(17)15-13-14-7-12(22-13)23(18,19)16-10-5-4-9(20-2)6-11(10)21-3/h4-7,16H,1-3H3,(H,14,15,17) |
| InChIKey | OBETXSPEMMCQRF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |