C9H10NO6S- — CID 122164830
(4-acetamido-3-methoxyphenyl) sulfate (PubChem CID 122164830) has the molecular formula C9H10NO6S- and a molecular weight of 260.25 g/mol. Its IUPAC name is (4-acetamido-3-methoxyphenyl) sulfate.
| Compound Name | (4-acetamido-3-methoxyphenyl) sulfate |
|---|---|
| PubChem CID | 122164830 |
| Molecular Formula | C9H10NO6S- |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | (4-acetamido-3-methoxyphenyl) sulfate |
| SMILES | COc1cc(OS(=O)(=O)[O-])ccc1NC(C)=O |
| InChI | InChI=1S/C9H11NO6S/c1-6(11)10-8-4-3-7(5-9(8)15-2)16-17(12,13)14/h3-5H,1-2H3,(H,10,11)(H,12,13,14)/p-1 |
| InChIKey | NZKKXAGORRATJB-UHFFFAOYSA-M |
| XLogP | 0.49 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|