C12H17N3O5S — CID 9302272
2-[(4-acetamido-3-methoxyphenyl)sulfonylamino]-N-methylacetamide (PubChem CID 9302272) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-[(4-acetamido-3-methoxyphenyl)sulfonylamino]-N-methylacetamide.
| Compound Name | 2-[(4-acetamido-3-methoxyphenyl)sulfonylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 9302272 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[(4-acetamido-3-methoxyphenyl)sulfonylamino]-N-methylacetamide |
| SMILES | CNC(=O)CNS(=O)(=O)c1ccc(NC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C12H17N3O5S/c1-8(16)15-10-5-4-9(6-11(10)20-3)21(18,19)14-7-12(17)13-2/h4-6,14H,7H2,1-3H3,(H,13,17)(H,15,16) |
| InChIKey | OUBUOHBOQBXDFF-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |