C14H21N3O5S — CID 9189598
2-[(4-acetamido-3-methoxyphenyl)sulfonylamino]-N-propan-2-ylacetamide (PubChem CID 9189598) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is 2-[(4-acetamido-3-methoxyphenyl)sulfonylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[(4-acetamido-3-methoxyphenyl)sulfonylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 9189598 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-[(4-acetamido-3-methoxyphenyl)sulfonylamino]-N-propan-2-ylacetamide |
| SMILES | COc1cc(S(=O)(=O)NCC(=O)NC(C)C)ccc1NC(C)=O |
| InChI | InChI=1S/C14H21N3O5S/c1-9(2)16-14(19)8-15-23(20,21)11-5-6-12(17-10(3)18)13(7-11)22-4/h5-7,9,15H,8H2,1-4H3,(H,16,19)(H,17,18) |
| InChIKey | IRVWCSXZOAZYJD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |