C10H15N3O5S — CID 126128860
N-(2-hydrazinyl-2-oxoethyl)-3,4-dimethoxybenzenesulfonamide (PubChem CID 126128860) has the molecular formula C10H15N3O5S and a molecular weight of 289.31 g/mol. Its IUPAC name is N-(2-hydrazinyl-2-oxoethyl)-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(2-hydrazinyl-2-oxoethyl)-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 126128860 |
| Molecular Formula | C10H15N3O5S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | N-(2-hydrazinyl-2-oxoethyl)-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(=O)NN)cc1OC |
| InChI | InChI=1S/C10H15N3O5S/c1-17-8-4-3-7(5-9(8)18-2)19(15,16)12-6-10(14)13-11/h3-5,12H,6,11H2,1-2H3,(H,13,14) |
| InChIKey | ZLBYYYNERQCSEQ-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|