C17H19NO6S — CID 110670619
(4-methylphenyl) 2-[(3,4-dimethoxyphenyl)sulfonylamino]acetate (PubChem CID 110670619) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is (4-methylphenyl) 2-[(3,4-dimethoxyphenyl)sulfonylamino]acetate.
| Compound Name | (4-methylphenyl) 2-[(3,4-dimethoxyphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 110670619 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (4-methylphenyl) 2-[(3,4-dimethoxyphenyl)sulfonylamino]acetate |
| SMILES | COc1ccc(S(=O)(=O)NCC(=O)Oc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C17H19NO6S/c1-12-4-6-13(7-5-12)24-17(19)11-18-25(20,21)14-8-9-15(22-2)16(10-14)23-3/h4-10,18H,11H2,1-3H3 |
| InChIKey | BAZJZZUECMTYRF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|