C17H19NO5S — CID 110670646
(4-methylphenyl) 2-[(4-ethoxyphenyl)sulfonylamino]acetate (PubChem CID 110670646) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is (4-methylphenyl) 2-[(4-ethoxyphenyl)sulfonylamino]acetate.
| Compound Name | (4-methylphenyl) 2-[(4-ethoxyphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 110670646 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (4-methylphenyl) 2-[(4-ethoxyphenyl)sulfonylamino]acetate |
| SMILES | CCOc1ccc(S(=O)(=O)NCC(=O)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H19NO5S/c1-3-22-14-8-10-16(11-9-14)24(20,21)18-12-17(19)23-15-6-4-13(2)5-7-15/h4-11,18H,3,12H2,1-2H3 |
| InChIKey | SHPSAFWKLYWIOP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|