C37H38O9S2 — CID 159893147
benzene;1-(4-ethoxyphenyl)sulfonyl-4-methylbenzene;[4-(4-ethoxyphenyl)sulfonylphenyl] methyl carbonate (PubChem CID 159893147) has the molecular formula C37H38O9S2 and a molecular weight of 690.84 g/mol. Its IUPAC name is benzene;1-(4-ethoxyphenyl)sulfonyl-4-methylbenzene;[4-(4-ethoxyphenyl)sulfonylphenyl] methyl carbonate.
| Compound Name | benzene;1-(4-ethoxyphenyl)sulfonyl-4-methylbenzene;[4-(4-ethoxyphenyl)sulfonylphenyl] methyl carbonate |
|---|---|
| PubChem CID | 159893147 |
| Molecular Formula | C37H38O9S2 |
| Molecular Weight | 690.84 g/mol |
| Exact Mass | 690.20 |
| IUPAC Name | benzene;1-(4-ethoxyphenyl)sulfonyl-4-methylbenzene;[4-(4-ethoxyphenyl)sulfonylphenyl] methyl carbonate |
| SMILES | CCOc1ccc(S(=O)(=O)c2ccc(C)cc2)cc1.CCOc1ccc(S(=O)(=O)c2ccc(OC(=O)OC)cc2)cc1.c1ccccc1 |
| InChI | InChI=1S/C16H16O6S.C15H16O3S.C6H6/c1-3-21-12-4-8-14(9-5-12)23(18,19)15-10-6-13(7-11-15)22-16(17)20-2;1-3-18-13-6-10-15(11-7-13)19(16,17)14-8-4-12(2)5-9-14;1-2-4-6-5-3-1/h4-11H,3H2,1-2H3;4-11H,3H2,1-2H3;1-6H |
| InChIKey | NUZWXUJGXCDQHK-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.84 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|