C18H22N2O5S — CID 55353301
2-(4-ethoxyphenoxy)-N'-(4-methylphenyl)sulfonylpropanehydrazide (PubChem CID 55353301) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)-N'-(4-methylphenyl)sulfonylpropanehydrazide.
| Compound Name | 2-(4-ethoxyphenoxy)-N'-(4-methylphenyl)sulfonylpropanehydrazide |
|---|---|
| PubChem CID | 55353301 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-(4-ethoxyphenoxy)-N'-(4-methylphenyl)sulfonylpropanehydrazide |
| SMILES | CCOc1ccc(OC(C)C(=O)NNS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H22N2O5S/c1-4-24-15-7-9-16(10-8-15)25-14(3)18(21)19-20-26(22,23)17-11-5-13(2)6-12-17/h5-12,14,20H,4H2,1-3H3,(H,19,21) |
| InChIKey | WXTOWAZOFRXTKX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|