C22H30N4O8S2 — CID 3116496
1-N',6-N'-bis[(4-ethoxyphenyl)sulfonyl]hexanedihydrazide (PubChem CID 3116496) has the molecular formula C22H30N4O8S2 and a molecular weight of 542.64 g/mol. Its IUPAC name is 1-N',6-N'-bis[(4-ethoxyphenyl)sulfonyl]hexanedihydrazide.
| Compound Name | 1-N',6-N'-bis[(4-ethoxyphenyl)sulfonyl]hexanedihydrazide |
|---|---|
| PubChem CID | 3116496 |
| Molecular Formula | C22H30N4O8S2 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 1-N',6-N'-bis[(4-ethoxyphenyl)sulfonyl]hexanedihydrazide |
| SMILES | CCOc1ccc(S(=O)(=O)NNC(=O)CCCCC(=O)NNS(=O)(=O)c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C22H30N4O8S2/c1-3-33-17-9-13-19(14-10-17)35(29,30)25-23-21(27)7-5-6-8-22(28)24-26-36(31,32)20-15-11-18(12-16-20)34-4-2/h9-16,25-26H,3-8H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | FSTXBBNYMMTHAC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|