C16H18N2O4S2 — CID 7478638
N'-(4-ethoxyphenyl)sulfonyl-2-phenylsulfanylacetohydrazide (PubChem CID 7478638) has the molecular formula C16H18N2O4S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is N'-(4-ethoxyphenyl)sulfonyl-2-phenylsulfanylacetohydrazide.
| Compound Name | N'-(4-ethoxyphenyl)sulfonyl-2-phenylsulfanylacetohydrazide |
|---|---|
| PubChem CID | 7478638 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | N'-(4-ethoxyphenyl)sulfonyl-2-phenylsulfanylacetohydrazide |
| SMILES | CCOc1ccc(S(=O)(=O)NNC(=O)CSc2ccccc2)cc1 |
| InChI | InChI=1S/C16H18N2O4S2/c1-2-22-13-8-10-15(11-9-13)24(20,21)18-17-16(19)12-23-14-6-4-3-5-7-14/h3-11,18H,2,12H2,1H3,(H,17,19) |
| InChIKey | MWJVZGSPURDAMX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|