C18H17N3O6S — CID 9244319
2-(1,3-dioxoisoindol-2-yl)-N'-(4-ethoxyphenyl)sulfonylacetohydrazide (PubChem CID 9244319) has the molecular formula C18H17N3O6S and a molecular weight of 403.42 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N'-(4-ethoxyphenyl)sulfonylacetohydrazide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N'-(4-ethoxyphenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 9244319 |
| Molecular Formula | C18H17N3O6S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N'-(4-ethoxyphenyl)sulfonylacetohydrazide |
| SMILES | CCOc1ccc(S(=O)(=O)NNC(=O)CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H17N3O6S/c1-2-27-12-7-9-13(10-8-12)28(25,26)20-19-16(22)11-21-17(23)14-5-3-4-6-15(14)18(21)24/h3-10,20H,2,11H2,1H3,(H,19,22) |
| InChIKey | WBKLSQCBJHEGDJ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|