C24H20N2O7S — CID 16596216
(1,3-dioxoisoindol-2-yl)methyl 4-[(4-ethoxyphenyl)sulfonylamino]benzoate (PubChem CID 16596216) has the molecular formula C24H20N2O7S and a molecular weight of 480.50 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 4-[(4-ethoxyphenyl)sulfonylamino]benzoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 4-[(4-ethoxyphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 16596216 |
| Molecular Formula | C24H20N2O7S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 4-[(4-ethoxyphenyl)sulfonylamino]benzoate |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(C(=O)OCN3C(=O)c4ccccc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C24H20N2O7S/c1-2-32-18-11-13-19(14-12-18)34(30,31)25-17-9-7-16(8-10-17)24(29)33-15-26-22(27)20-5-3-4-6-21(20)23(26)28/h3-14,25H,2,15H2,1H3 |
| InChIKey | GVXRMSYVEOVFAU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|