C25H27N3O9S2 — CID 25046962
(2-amino-2-oxoethyl) 3,5-bis[(4-ethoxyphenyl)sulfonylamino]benzoate (PubChem CID 25046962) has the molecular formula C25H27N3O9S2 and a molecular weight of 577.64 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 3,5-bis[(4-ethoxyphenyl)sulfonylamino]benzoate.
| Compound Name | (2-amino-2-oxoethyl) 3,5-bis[(4-ethoxyphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 25046962 |
| Molecular Formula | C25H27N3O9S2 |
| Molecular Weight | 577.64 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | (2-amino-2-oxoethyl) 3,5-bis[(4-ethoxyphenyl)sulfonylamino]benzoate |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cc(NS(=O)(=O)c3ccc(OCC)cc3)cc(C(=O)OCC(N)=O)c2)cc1 |
| InChI | InChI=1S/C25H27N3O9S2/c1-3-35-20-5-9-22(10-6-20)38(31,32)27-18-13-17(25(30)37-16-24(26)29)14-19(15-18)28-39(33,34)23-11-7-21(8-12-23)36-4-2/h5-15,27-28H,3-4,16H2,1-2H3,(H2,26,29) |
| InChIKey | WVXQKEUPUZQMDS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 180.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.64 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |