C20H23NO7S — CID 7938305
diethyl 5-[(4-ethoxyphenyl)sulfonylamino]benzene-1,3-dicarboxylate (PubChem CID 7938305) has the molecular formula C20H23NO7S and a molecular weight of 421.47 g/mol. Its IUPAC name is diethyl 5-[(4-ethoxyphenyl)sulfonylamino]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[(4-ethoxyphenyl)sulfonylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 7938305 |
| Molecular Formula | C20H23NO7S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | diethyl 5-[(4-ethoxyphenyl)sulfonylamino]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(NS(=O)(=O)c2ccc(OCC)cc2)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C20H23NO7S/c1-4-26-17-7-9-18(10-8-17)29(24,25)21-16-12-14(19(22)27-5-2)11-15(13-16)20(23)28-6-3/h7-13,21H,4-6H2,1-3H3 |
| InChIKey | DBEUQPIJQJAELI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |