C20H23NO8S — CID 22773009
diethyl 5-[(3,4-dimethoxyphenyl)sulfonylamino]benzene-1,3-dicarboxylate (PubChem CID 22773009) has the molecular formula C20H23NO8S and a molecular weight of 437.47 g/mol. Its IUPAC name is diethyl 5-[(3,4-dimethoxyphenyl)sulfonylamino]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[(3,4-dimethoxyphenyl)sulfonylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 22773009 |
| Molecular Formula | C20H23NO8S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | diethyl 5-[(3,4-dimethoxyphenyl)sulfonylamino]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(NS(=O)(=O)c2ccc(OC)c(OC)c2)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C20H23NO8S/c1-5-28-19(22)13-9-14(20(23)29-6-2)11-15(10-13)21-30(24,25)16-7-8-17(26-3)18(12-16)27-4/h7-12,21H,5-6H2,1-4H3 |
| InChIKey | VUHBZIBMHDYGDE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |