C16H16ClNO6S — CID 150284750
ethyl 2-chloro-5-[(3-hydroxy-4-methoxyphenyl)sulfamoyl]benzoate (PubChem CID 150284750) has the molecular formula C16H16ClNO6S and a molecular weight of 385.83 g/mol. Its IUPAC name is ethyl 2-chloro-5-[(3-hydroxy-4-methoxyphenyl)sulfamoyl]benzoate.
| Compound Name | ethyl 2-chloro-5-[(3-hydroxy-4-methoxyphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 150284750 |
| Molecular Formula | C16H16ClNO6S |
| Molecular Weight | 385.83 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | ethyl 2-chloro-5-[(3-hydroxy-4-methoxyphenyl)sulfamoyl]benzoate |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)Nc2ccc(OC)c(O)c2)ccc1Cl |
| InChI | InChI=1S/C16H16ClNO6S/c1-3-24-16(20)12-9-11(5-6-13(12)17)25(21,22)18-10-4-7-15(23-2)14(19)8-10/h4-9,18-19H,3H2,1-2H3 |
| InChIKey | GGILBEIRDKDPJY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.83 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |