C19H19ClN2O5S2 — CID 100737251
ethyl 2-chloro-5-[(2-oxo-3-propyl-1,3-benzothiazol-6-yl)sulfonylamino]benzoate (PubChem CID 100737251) has the molecular formula C19H19ClN2O5S2 and a molecular weight of 454.96 g/mol. Its IUPAC name is ethyl 2-chloro-5-[(2-oxo-3-propyl-1,3-benzothiazol-6-yl)sulfonylamino]benzoate.
| Compound Name | ethyl 2-chloro-5-[(2-oxo-3-propyl-1,3-benzothiazol-6-yl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 100737251 |
| Molecular Formula | C19H19ClN2O5S2 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | ethyl 2-chloro-5-[(2-oxo-3-propyl-1,3-benzothiazol-6-yl)sulfonylamino]benzoate |
| SMILES | CCCn1c(=O)sc2cc(S(=O)(=O)Nc3ccc(Cl)c(C(=O)OCC)c3)ccc21 |
| InChI | InChI=1S/C19H19ClN2O5S2/c1-3-9-22-16-8-6-13(11-17(16)28-19(22)24)29(25,26)21-12-5-7-15(20)14(10-12)18(23)27-4-2/h5-8,10-11,21H,3-4,9H2,1-2H3 |
| InChIKey | WDWQHWIJBMNNRK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |