C20H25N3O5S3 — CID 100736426
N-[4-(diethylsulfamoyl)phenyl]-2-oxo-3-propyl-1,3-benzothiazole-6-sulfonamide (PubChem CID 100736426) has the molecular formula C20H25N3O5S3 and a molecular weight of 483.64 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-2-oxo-3-propyl-1,3-benzothiazole-6-sulfonamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-2-oxo-3-propyl-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100736426 |
| Molecular Formula | C20H25N3O5S3 |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-2-oxo-3-propyl-1,3-benzothiazole-6-sulfonamide |
| SMILES | CCCn1c(=O)sc2cc(S(=O)(=O)Nc3ccc(S(=O)(=O)N(CC)CC)cc3)ccc21 |
| InChI | InChI=1S/C20H25N3O5S3/c1-4-13-23-18-12-11-17(14-19(18)29-20(23)24)30(25,26)21-15-7-9-16(10-8-15)31(27,28)22(5-2)6-3/h7-12,14,21H,4-6,13H2,1-3H3 |
| InChIKey | XSCMLKULUYBLMO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |