C17H15F4NO6S — CID 151740078
ethyl 5-[(3-fluoro-4-methoxyphenyl)sulfamoyl]-2-(trifluoromethoxy)benzoate (PubChem CID 151740078) has the molecular formula C17H15F4NO6S and a molecular weight of 437.37 g/mol. Its IUPAC name is ethyl 5-[(3-fluoro-4-methoxyphenyl)sulfamoyl]-2-(trifluoromethoxy)benzoate.
| Compound Name | ethyl 5-[(3-fluoro-4-methoxyphenyl)sulfamoyl]-2-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 151740078 |
| Molecular Formula | C17H15F4NO6S |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | ethyl 5-[(3-fluoro-4-methoxyphenyl)sulfamoyl]-2-(trifluoromethoxy)benzoate |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)Nc2ccc(OC)c(F)c2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C17H15F4NO6S/c1-3-27-16(23)12-9-11(5-7-14(12)28-17(19,20)21)29(24,25)22-10-4-6-15(26-2)13(18)8-10/h4-9,22H,3H2,1-2H3 |
| InChIKey | RMIMNHSNOLNBKU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |