C17H16F3NO6S — CID 139894037
ethyl 5-[(3,4-dimethoxyphenyl)sulfamoyl]-2,3,4-trifluorobenzoate (PubChem CID 139894037) has the molecular formula C17H16F3NO6S and a molecular weight of 419.38 g/mol. Its IUPAC name is ethyl 5-[(3,4-dimethoxyphenyl)sulfamoyl]-2,3,4-trifluorobenzoate.
| Compound Name | ethyl 5-[(3,4-dimethoxyphenyl)sulfamoyl]-2,3,4-trifluorobenzoate |
|---|---|
| PubChem CID | 139894037 |
| Molecular Formula | C17H16F3NO6S |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | ethyl 5-[(3,4-dimethoxyphenyl)sulfamoyl]-2,3,4-trifluorobenzoate |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)Nc2ccc(OC)c(OC)c2)c(F)c(F)c1F |
| InChI | InChI=1S/C17H16F3NO6S/c1-4-27-17(22)10-8-13(15(19)16(20)14(10)18)28(23,24)21-9-5-6-11(25-2)12(7-9)26-3/h5-8,21H,4H2,1-3H3 |
| InChIKey | SUXWOGVNZBBEDV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|