C20H19ClN2O7S — CID 100672822
ethyl 2-chloro-4-[[3-(2,5-dioxopyrrolidin-1-yl)-4-methoxyphenyl]sulfonylamino]benzoate (PubChem CID 100672822) has the molecular formula C20H19ClN2O7S and a molecular weight of 466.90 g/mol. Its IUPAC name is ethyl 2-chloro-4-[[3-(2,5-dioxopyrrolidin-1-yl)-4-methoxyphenyl]sulfonylamino]benzoate.
| Compound Name | ethyl 2-chloro-4-[[3-(2,5-dioxopyrrolidin-1-yl)-4-methoxyphenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 100672822 |
| Molecular Formula | C20H19ClN2O7S |
| Molecular Weight | 466.90 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | ethyl 2-chloro-4-[[3-(2,5-dioxopyrrolidin-1-yl)-4-methoxyphenyl]sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NS(=O)(=O)c2ccc(OC)c(N3C(=O)CCC3=O)c2)cc1Cl |
| InChI | InChI=1S/C20H19ClN2O7S/c1-3-30-20(26)14-6-4-12(10-15(14)21)22-31(27,28)13-5-7-17(29-2)16(11-13)23-18(24)8-9-19(23)25/h4-7,10-11,22H,3,8-9H2,1-2H3 |
| InChIKey | LMQMQSCZPQRZFV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.90 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|