C19H18N2O6S — CID 100539948
ethyl 3-[[4-(2,5-dioxopyrrolidin-1-yl)phenyl]sulfonylamino]benzoate (PubChem CID 100539948) has the molecular formula C19H18N2O6S and a molecular weight of 402.43 g/mol. Its IUPAC name is ethyl 3-[[4-(2,5-dioxopyrrolidin-1-yl)phenyl]sulfonylamino]benzoate.
| Compound Name | ethyl 3-[[4-(2,5-dioxopyrrolidin-1-yl)phenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 100539948 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | ethyl 3-[[4-(2,5-dioxopyrrolidin-1-yl)phenyl]sulfonylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NS(=O)(=O)c2ccc(N3C(=O)CCC3=O)cc2)c1 |
| InChI | InChI=1S/C19H18N2O6S/c1-2-27-19(24)13-4-3-5-14(12-13)20-28(25,26)16-8-6-15(7-9-16)21-17(22)10-11-18(21)23/h3-9,12,20H,2,10-11H2,1H3 |
| InChIKey | CZJAMBHZIYQBHW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|