C17H14N6O4S — CID 146021431
4-(2,5-dioxopyrrolidin-1-yl)-N-[3-(tetrazol-1-yl)phenyl]benzenesulfonamide (PubChem CID 146021431) has the molecular formula C17H14N6O4S and a molecular weight of 398.40 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-[3-(tetrazol-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[3-(tetrazol-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 146021431 |
| Molecular Formula | C17H14N6O4S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[3-(tetrazol-1-yl)phenyl]benzenesulfonamide |
| SMILES | O=C1CCC(=O)N1c1ccc(S(=O)(=O)Nc2cccc(-n3cnnn3)c2)cc1 |
| InChI | InChI=1S/C17H14N6O4S/c24-16-8-9-17(25)23(16)13-4-6-15(7-5-13)28(26,27)19-12-2-1-3-14(10-12)22-11-18-20-21-22/h1-7,10-11,19H,8-9H2 |
| InChIKey | LKYPZSSDESJJDN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|