C15H9F6N5O2S — CID 166204102
N-[3,5-bis(trifluoromethyl)phenyl]-4-(tetrazol-1-yl)benzenesulfonamide (PubChem CID 166204102) has the molecular formula C15H9F6N5O2S and a molecular weight of 437.33 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-4-(tetrazol-1-yl)benzenesulfonamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-(tetrazol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 166204102 |
| Molecular Formula | C15H9F6N5O2S |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-(tetrazol-1-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C15H9F6N5O2S/c16-14(17,18)9-5-10(15(19,20)21)7-11(6-9)23-29(27,28)13-3-1-12(2-4-13)26-8-22-24-25-26/h1-8,23H |
| InChIKey | HKNHBDOGBBXSLN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |