C15H12N5O4S- — CID 7042585
2-methyl-5-[[4-(tetrazol-1-yl)phenyl]sulfamoyl]benzoate (PubChem CID 7042585) has the molecular formula C15H12N5O4S- and a molecular weight of 358.36 g/mol. Its IUPAC name is 2-methyl-5-[[4-(tetrazol-1-yl)phenyl]sulfamoyl]benzoate.
| Compound Name | 2-methyl-5-[[4-(tetrazol-1-yl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 7042585 |
| Molecular Formula | C15H12N5O4S- |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 2-methyl-5-[[4-(tetrazol-1-yl)phenyl]sulfamoyl]benzoate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(-n3cnnn3)cc2)cc1C(=O)[O-] |
| InChI | InChI=1S/C15H13N5O4S/c1-10-2-7-13(8-14(10)15(21)22)25(23,24)17-11-3-5-12(6-4-11)20-9-16-18-19-20/h2-9,17H,1H3,(H,21,22)/p-1 |
| InChIKey | DPPUKELQRVQKGP-UHFFFAOYSA-M |
| XLogP | 0.14 |
| TPSA | 129.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |