C22H20NO4S2- — CID 7042288
5-[[4-(2,4-dimethylphenyl)sulfanylphenyl]sulfamoyl]-2-methylbenzoate (PubChem CID 7042288) has the molecular formula C22H20NO4S2- and a molecular weight of 426.54 g/mol. Its IUPAC name is 5-[[4-(2,4-dimethylphenyl)sulfanylphenyl]sulfamoyl]-2-methylbenzoate.
| Compound Name | 5-[[4-(2,4-dimethylphenyl)sulfanylphenyl]sulfamoyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 7042288 |
| Molecular Formula | C22H20NO4S2- |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 5-[[4-(2,4-dimethylphenyl)sulfanylphenyl]sulfamoyl]-2-methylbenzoate |
| SMILES | Cc1ccc(Sc2ccc(NS(=O)(=O)c3ccc(C)c(C(=O)[O-])c3)cc2)c(C)c1 |
| InChI | InChI=1S/C22H21NO4S2/c1-14-4-11-21(16(3)12-14)28-18-8-6-17(7-9-18)23-29(26,27)19-10-5-15(2)20(13-19)22(24)25/h4-13,23H,1-3H3,(H,24,25)/p-1 |
| InChIKey | USSMVPGBQYXJDW-UHFFFAOYSA-M |
| XLogP | 3.93 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |