C15H16S — CID 15456660
2,4-dimethyl-1-(4-methylphenyl)sulfanylbenzene (PubChem CID 15456660) has the molecular formula C15H16S and a molecular weight of 228.36 g/mol. Its IUPAC name is 2,4-dimethyl-1-(4-methylphenyl)sulfanylbenzene.
| Compound Name | 2,4-dimethyl-1-(4-methylphenyl)sulfanylbenzene |
|---|---|
| PubChem CID | 15456660 |
| Molecular Formula | C15H16S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2,4-dimethyl-1-(4-methylphenyl)sulfanylbenzene |
| SMILES | Cc1ccc(Sc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C15H16S/c1-11-4-7-14(8-5-11)16-15-9-6-12(2)10-13(15)3/h4-10H,1-3H3 |
| InChIKey | NSMLPPJWQGDWSE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |