C28H27S2+ — CID 143426165
[5-methyl-2-(4-methylphenyl)sulfanylphenyl]-bis(4-methylphenyl)sulfanium (PubChem CID 143426165) has the molecular formula C28H27S2+ and a molecular weight of 427.66 g/mol. Its IUPAC name is [5-methyl-2-(4-methylphenyl)sulfanylphenyl]-bis(4-methylphenyl)sulfanium.
| Compound Name | [5-methyl-2-(4-methylphenyl)sulfanylphenyl]-bis(4-methylphenyl)sulfanium |
|---|---|
| PubChem CID | 143426165 |
| Molecular Formula | C28H27S2+ |
| Molecular Weight | 427.66 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | [5-methyl-2-(4-methylphenyl)sulfanylphenyl]-bis(4-methylphenyl)sulfanium |
| SMILES | Cc1ccc(Sc2ccc(C)cc2[S+](c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H27S2/c1-20-5-12-24(13-6-20)29-27-18-11-23(4)19-28(27)30(25-14-7-21(2)8-15-25)26-16-9-22(3)10-17-26/h5-19H,1-4H3/q+1 |
| InChIKey | CZUOGXPTBOEQAT-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.66 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|