C32H22ClF2OS2+ — CID 22619549
[4-[2-chloro-4-(4-methylbenzoyl)phenyl]sulfanylphenyl]-bis(4-fluorophenyl)sulfanium (PubChem CID 22619549) has the molecular formula C32H22ClF2OS2+ and a molecular weight of 560.11 g/mol. Its IUPAC name is [4-[2-chloro-4-(4-methylbenzoyl)phenyl]sulfanylphenyl]-bis(4-fluorophenyl)sulfanium.
| Compound Name | [4-[2-chloro-4-(4-methylbenzoyl)phenyl]sulfanylphenyl]-bis(4-fluorophenyl)sulfanium |
|---|---|
| PubChem CID | 22619549 |
| Molecular Formula | C32H22ClF2OS2+ |
| Molecular Weight | 560.11 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | [4-[2-chloro-4-(4-methylbenzoyl)phenyl]sulfanylphenyl]-bis(4-fluorophenyl)sulfanium |
| SMILES | Cc1ccc(C(=O)c2ccc(Sc3ccc([S+](c4ccc(F)cc4)c4ccc(F)cc4)cc3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C32H22ClF2OS2/c1-21-2-4-22(5-3-21)32(36)23-6-19-31(30(33)20-23)37-26-11-17-29(18-12-26)38(27-13-7-24(34)8-14-27)28-15-9-25(35)10-16-28/h2-20H,1H3/q+1 |
| InChIKey | NDUHPOSFSFVRQV-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.11 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|