C32H25ClOS2 — CID 145162699
[3-chloro-4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]sulfanylphenyl]-phenylmethanone (PubChem CID 145162699) has the molecular formula C32H25ClOS2 and a molecular weight of 525.14 g/mol. Its IUPAC name is [3-chloro-4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]sulfanylphenyl]-phenylmethanone.
| Compound Name | [3-chloro-4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]sulfanylphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 145162699 |
| Molecular Formula | C32H25ClOS2 |
| Molecular Weight | 525.14 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | [3-chloro-4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]sulfanylphenyl]-phenylmethanone |
| SMILES | CS(c1ccccc1)(c1ccccc1)c1ccc(Sc2ccc(C(=O)c3ccccc3)cc2Cl)cc1 |
| InChI | InChI=1S/C32H25ClOS2/c1-36(27-13-7-3-8-14-27,28-15-9-4-10-16-28)29-20-18-26(19-21-29)35-31-22-17-25(23-30(31)33)32(34)24-11-5-2-6-12-24/h2-23H,1H3 |
| InChIKey | LVEUALFIZQQRBL-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.14 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |