About phenyl-[4-(trimethyl-λ4-sulfanyl)phenyl]methanone
phenyl-[4-(trimethyl-λ4-sulfanyl)phenyl]methanone (PubChem CID 126595551) has the molecular formula C16H18OS
and a molecular weight of 258.39 g/mol. Its IUPAC name is phenyl-[4-(trimethyl-λ4-sulfanyl)phenyl]methanone.
Molecular Properties
| Compound Name | phenyl-[4-(trimethyl-λ4-sulfanyl)phenyl]methanone |
| PubChem CID | 126595551 |
| Molecular Formula | C16H18OS |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | phenyl-[4-(trimethyl-λ4-sulfanyl)phenyl]methanone |
| SMILES | CS(C)(C)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H18OS/c1-18(2,3)15-11-9-14(10-12-15)16(17)13-7-5-4-6-8-13/h4-12H,1-3H3 |
| InChIKey | VZLJOQRNPMUEHL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze phenyl-[4-(trimethyl-λ4-sulfanyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-[4-(trimethyl-λ4-sulfanyl)phenyl]methanone?
The IUPAC name of phenyl-[4-(trimethyl-λ4-sulfanyl)phenyl]methanone (CID 126595551) is phenyl-[4-(trimethyl-λ4-sulfanyl)phenyl]methanone.
What is the SMILES notation for phenyl-[4-(trimethyl-λ4-sulfanyl)phenyl]methanone?
The canonical SMILES for phenyl-[4-(trimethyl-λ4-sulfanyl)phenyl]methanone is CS(C)(C)c1ccc(C(=O)c2ccccc2)cc1.
What is the InChIKey of phenyl-[4-(trimethyl-λ4-sulfanyl)phenyl]methanone?
The InChIKey is VZLJOQRNPMUEHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18OS/c1-18(2,3)15-11-9-14(10-12-15)16(17)13-7-5-4-6-8-13/h4-12H,1-3H3.
What are the key properties of phenyl-[4-(trimethyl-λ4-sulfanyl)phenyl]methanone?
phenyl-[4-(trimethyl-λ4-sulfanyl)phenyl]methanone has a molecular weight of 258.39 g/mol, XLogP of 3.97, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-[4-(trimethyl-λ4-sulfanyl)phenyl]methanone is sourced from PubChem (CID 126595551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).