C31H22Cl2O5S2 — CID 140632972
[[4-(4-benzoyl-2-chlorophenyl)sulfanylphenyl]-diphenyl-λ4-sulfanyl] perchlorate (PubChem CID 140632972) has the molecular formula C31H22Cl2O5S2 and a molecular weight of 609.55 g/mol. Its IUPAC name is [[4-(4-benzoyl-2-chlorophenyl)sulfanylphenyl]-diphenyl-λ4-sulfanyl] perchlorate.
| Compound Name | [[4-(4-benzoyl-2-chlorophenyl)sulfanylphenyl]-diphenyl-λ4-sulfanyl] perchlorate |
|---|---|
| PubChem CID | 140632972 |
| Molecular Formula | C31H22Cl2O5S2 |
| Molecular Weight | 609.55 g/mol |
| Exact Mass | 608.03 |
| IUPAC Name | [[4-(4-benzoyl-2-chlorophenyl)sulfanylphenyl]-diphenyl-λ4-sulfanyl] perchlorate |
| SMILES | O=C(c1ccccc1)c1ccc(Sc2ccc(S(O[Cl+3]([O-])([O-])[O-])(c3ccccc3)c3ccccc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C31H22Cl2O5S2/c32-29-22-24(31(34)23-10-4-1-5-11-23)16-21-30(29)39-25-17-19-28(20-18-25)40(38-33(35,36)37,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-22H |
| InChIKey | JESHPNMSKBMACK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 95.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.55 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |