C32H19ClF6O6S2 — CID 139989886
[[4-(3-benzoyl-4-fluorophenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] perchlorate (PubChem CID 139989886) has the molecular formula C32H19ClF6O6S2 and a molecular weight of 713.07 g/mol. Its IUPAC name is [[4-(3-benzoyl-4-fluorophenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] perchlorate.
| Compound Name | [[4-(3-benzoyl-4-fluorophenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] perchlorate |
|---|---|
| PubChem CID | 139989886 |
| Molecular Formula | C32H19ClF6O6S2 |
| Molecular Weight | 713.07 g/mol |
| Exact Mass | 712.02 |
| IUPAC Name | [[4-(3-benzoyl-4-fluorophenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] perchlorate |
| SMILES | COc1ccc(S(O[Cl+3]([O-])([O-])[O-])(c2ccc(Sc3ccc(F)c(C(=O)c4ccccc4)c3)cc2)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C32H19ClF6O6S2/c1-44-19-7-12-22(13-8-19)47(45-33(41,42)43,32-29(38)27(36)26(35)28(37)30(32)39)23-14-9-20(10-15-23)46-21-11-16-25(34)24(17-21)31(40)18-5-3-2-4-6-18/h2-17H,1H3 |
| InChIKey | RCGIJMOGDNLDDO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 104.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.07 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|