C36H20F14O5S3 — CID 139989819
[[4-(2-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 139989819) has the molecular formula C36H20F14O5S3 and a molecular weight of 894.72 g/mol. Its IUPAC name is [[4-(2-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [[4-(2-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 139989819 |
| Molecular Formula | C36H20F14O5S3 |
| Molecular Weight | 894.72 g/mol |
| Exact Mass | 894.02 |
| IUPAC Name | [[4-(2-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | COc1ccc(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c2ccc(Sc3ccccc3C(=O)c3ccccc3)cc2)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C36H20F14O5S3/c1-54-20-11-15-22(16-12-20)57(32-29(40)27(38)26(37)28(39)30(32)41,55-58(52,53)36(49,50)34(44,45)33(42,43)35(46,47)48)23-17-13-21(14-18-23)56-25-10-6-5-9-24(25)31(51)19-7-3-2-4-8-19/h2-18H,1H3 |
| InChIKey | BGBSXKZWHDASNS-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.72 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|