C29H21F9O3S3 — CID 140900194
[(3-methyl-4-phenylsulfanylphenyl)-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 140900194) has the molecular formula C29H21F9O3S3 and a molecular weight of 684.67 g/mol. Its IUPAC name is [(3-methyl-4-phenylsulfanylphenyl)-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [(3-methyl-4-phenylsulfanylphenyl)-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 140900194 |
| Molecular Formula | C29H21F9O3S3 |
| Molecular Weight | 684.67 g/mol |
| Exact Mass | 684.05 |
| IUPAC Name | [(3-methyl-4-phenylsulfanylphenyl)-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | Cc1cc(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c2ccccc2)c2ccccc2)ccc1Sc1ccccc1 |
| InChI | InChI=1S/C29H21F9O3S3/c1-20-19-24(17-18-25(20)42-21-11-5-2-6-12-21)43(22-13-7-3-8-14-22,23-15-9-4-10-16-23)41-44(39,40)29(37,38)27(32,33)26(30,31)28(34,35)36/h2-19H,1H3 |
| InChIKey | IDQMSOQNHMWTQF-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.67 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|