C11H11F7O3S2 — CID 87263744
[dimethyl(phenyl)-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate (PubChem CID 87263744) has the molecular formula C11H11F7O3S2 and a molecular weight of 388.33 g/mol. Its IUPAC name is [dimethyl(phenyl)-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate.
| Compound Name | [dimethyl(phenyl)-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 87263744 |
| Molecular Formula | C11H11F7O3S2 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | [dimethyl(phenyl)-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate |
| SMILES | CS(C)(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H11F7O3S2/c1-22(2,8-6-4-3-5-7-8)21-23(19,20)11(17,18)9(12,13)10(14,15)16/h3-7H,1-2H3 |
| InChIKey | IMHYCHKBHBTRGY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|