C11H15F3O3S2 — CID 87831914
[diethyl(phenyl)-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 87831914) has the molecular formula C11H15F3O3S2 and a molecular weight of 316.37 g/mol. Its IUPAC name is [diethyl(phenyl)-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [diethyl(phenyl)-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87831914 |
| Molecular Formula | C11H15F3O3S2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | [diethyl(phenyl)-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | CCS(CC)(OS(=O)(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H15F3O3S2/c1-3-18(4-2,10-8-6-5-7-9-10)17-19(15,16)11(12,13)14/h5-9H,3-4H2,1-2H3 |
| InChIKey | DZUNDMRDHYYGOK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|