C19H14F8O3S3 — CID 171802848
[[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 171802848) has the molecular formula C19H14F8O3S3 and a molecular weight of 538.50 g/mol. Its IUPAC name is [[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171802848 |
| Molecular Formula | C19H14F8O3S3 |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.00 |
| IUPAC Name | [[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OS(c1ccccc1)(c1ccccc1)c1cccc(S(F)(F)(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C19H14F8O3S3/c20-19(21,22)32(28,29)30-31(15-8-3-1-4-9-15,16-10-5-2-6-11-16)17-12-7-13-18(14-17)33(23,24,25,26)27/h1-14H |
| InChIKey | JEXXHTMGKAIHMG-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|