About [[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate
[[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 171802848) has the molecular formula C19H14F8O3S3
and a molecular weight of 538.50 g/mol. Its IUPAC name is [[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate |
| PubChem CID | 171802848 |
| Molecular Formula | C19H14F8O3S3 |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.00 |
| IUPAC Name | [[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OS(c1ccccc1)(c1ccccc1)c1cccc(S(F)(F)(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C19H14F8O3S3/c20-19(21,22)32(28,29)30-31(15-8-3-1-4-9-15,16-10-5-2-6-11-16)17-12-7-13-18(14-17)33(23,24,25,26)27/h1-14H |
| InChIKey | JEXXHTMGKAIHMG-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate?
The IUPAC name of [[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate (CID 171802848) is [[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate.
What is the SMILES notation for [[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate?
The canonical SMILES for [[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate is O=S(=O)(OS(c1ccccc1)(c1ccccc1)c1cccc(S(F)(F)(F)(F)F)c1)C(F)(F)F.
What is the InChIKey of [[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate?
The InChIKey is JEXXHTMGKAIHMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F8O3S3/c20-19(21,22)32(28,29)30-31(15-8-3-1-4-9-15,16-10-5-2-6-11-16)17-12-7-13-18(14-17)33(23,24,25,26)27/h1-14H.
What are the key properties of [[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate?
[[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate has a molecular weight of 538.50 g/mol, XLogP of 8.41, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[3-(pentafluoro-λ6-sulfanyl)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate is sourced from PubChem (CID 171802848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).