C26H19F4IO4S2 — CID 176652767
(triphenyl-λ4-sulfanyl) 1,1,2,2-tetrafluoro-2-(3-iodophenoxy)ethanesulfonate (PubChem CID 176652767) has the molecular formula C26H19F4IO4S2 and a molecular weight of 662.46 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) 1,1,2,2-tetrafluoro-2-(3-iodophenoxy)ethanesulfonate.
| Compound Name | (triphenyl-λ4-sulfanyl) 1,1,2,2-tetrafluoro-2-(3-iodophenoxy)ethanesulfonate |
|---|---|
| PubChem CID | 176652767 |
| Molecular Formula | C26H19F4IO4S2 |
| Molecular Weight | 662.46 g/mol |
| Exact Mass | 661.97 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) 1,1,2,2-tetrafluoro-2-(3-iodophenoxy)ethanesulfonate |
| SMILES | O=S(=O)(OS(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)C(F)(F)Oc1cccc(I)c1 |
| InChI | InChI=1S/C26H19F4IO4S2/c27-25(28,34-21-12-10-11-20(31)19-21)26(29,30)37(32,33)35-36(22-13-4-1-5-14-22,23-15-6-2-7-16-23)24-17-8-3-9-18-24/h1-19H |
| InChIKey | NBMWZRUWLGWATN-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.46 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|