C71H94F6O10S4 — CID 141160663
bis[bis(4-octoxyphenyl)-phenyl-λ4-sulfanyl] 1,1,2,2,3,3-hexafluoropropane-1,3-disulfonate (PubChem CID 141160663) has the molecular formula C71H94F6O10S4 and a molecular weight of 1349.78 g/mol. Its IUPAC name is bis[bis(4-octoxyphenyl)-phenyl-λ4-sulfanyl] 1,1,2,2,3,3-hexafluoropropane-1,3-disulfonate.
| Compound Name | bis[bis(4-octoxyphenyl)-phenyl-λ4-sulfanyl] 1,1,2,2,3,3-hexafluoropropane-1,3-disulfonate |
|---|---|
| PubChem CID | 141160663 |
| Molecular Formula | C71H94F6O10S4 |
| Molecular Weight | 1349.78 g/mol |
| Exact Mass | 1348.56 |
| IUPAC Name | bis[bis(4-octoxyphenyl)-phenyl-λ4-sulfanyl] 1,1,2,2,3,3-hexafluoropropane-1,3-disulfonate |
| SMILES | CCCCCCCCOc1ccc(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)OS(c2ccccc2)(c2ccc(OCCCCCCCC)cc2)c2ccc(OCCCCCCCC)cc2)(c2ccccc2)c2ccc(OCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C71H94F6O10S4/c1-5-9-13-17-21-31-55-82-59-39-47-65(48-40-59)88(63-35-27-25-28-36-63,66-49-41-60(42-50-66)83-56-32-22-18-14-10-6-2)86-90(78,79)70(74,75)69(72,73)71(76,77)91(80,81)87-89(64-37-29-26-30-38-64,67-51-43-61(44-52-67)84-57-33-23-19-15-11-7-3)68-53-45-62(46-54-68)85-58-34-24-20-16-12-8-4/h25-30,35-54H,5-24,31-34,55-58H2,1-4H3 |
| InChIKey | GEDUHWYBRBKGAC-UHFFFAOYSA-N |
| XLogP | 22.25 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 91 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1349.78 |
| LogP ≤ 5 | 22.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|