C21H15F21O3S — CID 88527521
1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfonyl)-4-pentoxybenzene (PubChem CID 88527521) has the molecular formula C21H15F21O3S and a molecular weight of 746.37 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfonyl)-4-pentoxybenzene.
| Compound Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfonyl)-4-pentoxybenzene |
|---|---|
| PubChem CID | 88527521 |
| Molecular Formula | C21H15F21O3S |
| Molecular Weight | 746.37 g/mol |
| Exact Mass | 746.04 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfonyl)-4-pentoxybenzene |
| SMILES | CCCCCOc1ccc(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H15F21O3S/c1-2-3-4-9-45-10-5-7-11(8-6-10)46(43,44)21(41,42)19(36,37)17(32,33)15(28,29)13(24,25)12(22,23)14(26,27)16(30,31)18(34,35)20(38,39)40/h5-8H,2-4,9H2,1H3 |
| InChIKey | IYFYHNGCZOBPJG-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.37 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|