C26H30F3O4PS — CID 159154922
(4-heptoxyphenyl)-diphenylphosphanium;trifluoromethanesulfonate (PubChem CID 159154922) has the molecular formula C26H30F3O4PS and a molecular weight of 526.56 g/mol. Its IUPAC name is (4-heptoxyphenyl)-diphenylphosphanium;trifluoromethanesulfonate.
| Compound Name | (4-heptoxyphenyl)-diphenylphosphanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159154922 |
| Molecular Formula | C26H30F3O4PS |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | (4-heptoxyphenyl)-diphenylphosphanium;trifluoromethanesulfonate |
| SMILES | CCCCCCCOc1ccc([PH+](c2ccccc2)c2ccccc2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C25H29OP.CHF3O3S/c1-2-3-4-5-12-21-26-22-17-19-25(20-18-22)27(23-13-8-6-9-14-23)24-15-10-7-11-16-24;2-1(3,4)8(5,6)7/h6-11,13-20H,2-5,12,21H2,1H3;(H,5,6,7) |
| InChIKey | KJTOEQRPJFNJCR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|