C29H28F3I2O4S+ — CID 171926953
(4-butoxyphenyl)-phenyliodanium;diphenyliodanium;trifluoromethanesulfonate (PubChem CID 171926953) has the molecular formula C29H28F3I2O4S+ and a molecular weight of 783.41 g/mol. Its IUPAC name is (4-butoxyphenyl)-phenyliodanium;diphenyliodanium;trifluoromethanesulfonate.
| Compound Name | (4-butoxyphenyl)-phenyliodanium;diphenyliodanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171926953 |
| Molecular Formula | C29H28F3I2O4S+ |
| Molecular Weight | 783.41 g/mol |
| Exact Mass | 782.97 |
| IUPAC Name | (4-butoxyphenyl)-phenyliodanium;diphenyliodanium;trifluoromethanesulfonate |
| SMILES | CCCCOc1ccc([I+]c2ccccc2)cc1.O=S(=O)([O-])C(F)(F)F.c1ccc([I+]c2ccccc2)cc1 |
| InChI | InChI=1S/C16H18IO.C12H10I.CHF3O3S/c1-2-3-13-18-16-11-9-15(10-12-16)17-14-7-5-4-6-8-14;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3,4)8(5,6)7/h4-12H,2-3,13H2,1H3;1-10H;(H,5,6,7)/q2*+1;/p-1 |
| InChIKey | ZGHBNIKECHQAPL-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|