C70H94F4O10S4 — CID 175756760
bis(bis(4-octoxyphenyl)-phenylsulfanium);1,1,2,2-tetrafluoroethane-1,2-disulfonate (PubChem CID 175756760) has the molecular formula C70H94F4O10S4 and a molecular weight of 1299.77 g/mol. Its IUPAC name is bis(bis(4-octoxyphenyl)-phenylsulfanium);1,1,2,2-tetrafluoroethane-1,2-disulfonate.
| Compound Name | bis(bis(4-octoxyphenyl)-phenylsulfanium);1,1,2,2-tetrafluoroethane-1,2-disulfonate |
|---|---|
| PubChem CID | 175756760 |
| Molecular Formula | C70H94F4O10S4 |
| Molecular Weight | 1299.77 g/mol |
| Exact Mass | 1298.57 |
| IUPAC Name | bis(bis(4-octoxyphenyl)-phenylsulfanium);1,1,2,2-tetrafluoroethane-1,2-disulfonate |
| SMILES | CCCCCCCCOc1ccc([S+](c2ccccc2)c2ccc(OCCCCCCCC)cc2)cc1.CCCCCCCCOc1ccc([S+](c2ccccc2)c2ccc(OCCCCCCCC)cc2)cc1.O=S(=O)([O-])C(F)(F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/2C34H47O2S.C2H2F4O6S2/c2*1-3-5-7-9-11-16-28-35-30-20-24-33(25-21-30)37(32-18-14-13-15-19-32)34-26-22-31(23-27-34)36-29-17-12-10-8-6-4-2;3-1(4,13(7,8)9)2(5,6)14(10,11)12/h2*13-15,18-27H,3-12,16-17,28-29H2,1-2H3;(H,7,8,9)(H,10,11,12)/q2*+1;/p-2 |
| InChIKey | XXBJXSYSAXKOBR-UHFFFAOYSA-L |
| XLogP | 19.78 |
| TPSA | 151.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1299.77 |
| LogP ≤ 5 | 19.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|