About hydrogen carbonate;tris(4-hexoxyphenyl)sulfanium
hydrogen carbonate;tris(4-hexoxyphenyl)sulfanium (PubChem CID 161198618) has the molecular formula C37H52O6S
and a molecular weight of 624.88 g/mol. Its IUPAC name is hydrogen carbonate;tris(4-hexoxyphenyl)sulfanium.
Molecular Properties
| Compound Name | hydrogen carbonate;tris(4-hexoxyphenyl)sulfanium |
| PubChem CID | 161198618 |
| Molecular Formula | C37H52O6S |
| Molecular Weight | 624.88 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | hydrogen carbonate;tris(4-hexoxyphenyl)sulfanium |
| SMILES | CCCCCCOc1ccc([S+](c2ccc(OCCCCCC)cc2)c2ccc(OCCCCCC)cc2)cc1.O=C([O-])O |
| InChI | InChI=1S/C36H51O3S.CH2O3/c1-4-7-10-13-28-37-31-16-22-34(23-17-31)40(35-24-18-32(19-25-35)38-29-14-11-8-5-2)36-26-20-33(21-27-36)39-30-15-12-9-6-3;2-1(3)4/h16-27H,4-15,28-30H2,1-3H3;(H2,2,3,4)/q+1;/p-1 |
| InChIKey | UURKMAOHTBMDNJ-UHFFFAOYSA-M |
| XLogP | 9.55 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 624.88 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze hydrogen carbonate;tris(4-hexoxyphenyl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen carbonate;tris(4-hexoxyphenyl)sulfanium?
The IUPAC name of hydrogen carbonate;tris(4-hexoxyphenyl)sulfanium (CID 161198618) is hydrogen carbonate;tris(4-hexoxyphenyl)sulfanium.
What is the SMILES notation for hydrogen carbonate;tris(4-hexoxyphenyl)sulfanium?
The canonical SMILES for hydrogen carbonate;tris(4-hexoxyphenyl)sulfanium is CCCCCCOc1ccc([S+](c2ccc(OCCCCCC)cc2)c2ccc(OCCCCCC)cc2)cc1.O=C([O-])O.
What is the InChIKey of hydrogen carbonate;tris(4-hexoxyphenyl)sulfanium?
The InChIKey is UURKMAOHTBMDNJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C36H51O3S.CH2O3/c1-4-7-10-13-28-37-31-16-22-34(23-17-31)40(35-24-18-32(19-25-35)38-29-14-11-8-5-2)36-26-20-33(21-27-36)39-30-15-12-9-6-3;2-1(3)4/h16-27H,4-15,28-30H2,1-3H3;(H2,2,3,4)/q+1;/p-1.
What are the key properties of hydrogen carbonate;tris(4-hexoxyphenyl)sulfanium?
hydrogen carbonate;tris(4-hexoxyphenyl)sulfanium has a molecular weight of 624.88 g/mol, XLogP of 9.55, 21 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen carbonate;tris(4-hexoxyphenyl)sulfanium is sourced from PubChem (CID 161198618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).