C23H23F3O4S2 — CID 23133224
(2-butoxyphenyl)-diphenylsulfanium;trifluoromethanesulfonate (PubChem CID 23133224) has the molecular formula C23H23F3O4S2 and a molecular weight of 484.56 g/mol. Its IUPAC name is (2-butoxyphenyl)-diphenylsulfanium;trifluoromethanesulfonate.
| Compound Name | (2-butoxyphenyl)-diphenylsulfanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 23133224 |
| Molecular Formula | C23H23F3O4S2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | (2-butoxyphenyl)-diphenylsulfanium;trifluoromethanesulfonate |
| SMILES | CCCCOc1ccccc1[S+](c1ccccc1)c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C22H23OS.CHF3O3S/c1-2-3-18-23-21-16-10-11-17-22(21)24(19-12-6-4-7-13-19)20-14-8-5-9-15-20;2-1(3,4)8(5,6)7/h4-17H,2-3,18H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | TVHSJZKSDKQWKU-UHFFFAOYSA-M |
| XLogP | 6.01 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|