C43H43F3O6S2 — CID 162622753
[2-(2-anthracen-1-ylethoxy)phenyl]-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;trifluoromethanesulfonate (PubChem CID 162622753) has the molecular formula C43H43F3O6S2 and a molecular weight of 776.94 g/mol. Its IUPAC name is [2-(2-anthracen-1-ylethoxy)phenyl]-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;trifluoromethanesulfonate.
| Compound Name | [2-(2-anthracen-1-ylethoxy)phenyl]-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162622753 |
| Molecular Formula | C43H43F3O6S2 |
| Molecular Weight | 776.94 g/mol |
| Exact Mass | 776.25 |
| IUPAC Name | [2-(2-anthracen-1-ylethoxy)phenyl]-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfanium;trifluoromethanesulfonate |
| SMILES | CC(C)(C)Oc1ccc([S+](c2ccc(OC(C)(C)C)cc2)c2ccccc2OCCc2cccc3cc4ccccc4cc23)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C42H43O3S.CHF3O3S/c1-41(2,3)44-34-18-22-36(23-19-34)46(37-24-20-35(21-25-37)45-42(4,5)6)40-17-10-9-16-39(40)43-27-26-30-14-11-15-33-28-31-12-7-8-13-32(31)29-38(30)33;2-1(3,4)8(5,6)7/h7-25,28-29H,26-27H2,1-6H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | VQZHHCUTQOGRGK-UHFFFAOYSA-M |
| XLogP | 11.12 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.94 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|