C48H49F3O11S2 — CID 162622577
bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-[2-(2-phenanthren-9-ylethoxymethoxy)phenyl]sulfanium;trifluoromethanesulfonate (PubChem CID 162622577) has the molecular formula C48H49F3O11S2 and a molecular weight of 923.04 g/mol. Its IUPAC name is bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-[2-(2-phenanthren-9-ylethoxymethoxy)phenyl]sulfanium;trifluoromethanesulfonate.
| Compound Name | bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-[2-(2-phenanthren-9-ylethoxymethoxy)phenyl]sulfanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162622577 |
| Molecular Formula | C48H49F3O11S2 |
| Molecular Weight | 923.04 g/mol |
| Exact Mass | 922.27 |
| IUPAC Name | bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-[2-(2-phenanthren-9-ylethoxymethoxy)phenyl]sulfanium;trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)COc1ccc([S+](c2ccc(OCC(=O)OC(C)(C)C)cc2)c2ccccc2OCOCCc2cc3ccccc3c3ccccc23)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C47H49O8S.CHF3O3S/c1-46(2,3)54-44(48)30-51-35-19-23-37(24-20-35)56(38-25-21-36(22-26-38)52-31-45(49)55-47(4,5)6)43-18-12-11-17-42(43)53-32-50-28-27-34-29-33-13-7-8-14-39(33)41-16-10-9-15-40(34)41;2-1(3,4)8(5,6)7/h7-26,29H,27-28,30-32H2,1-6H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | WXULHEAUNBUVEB-UHFFFAOYSA-M |
| XLogP | 10.18 |
| TPSA | 146.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.04 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|