C30H28F2O6S2 — CID 22057299
2,4-difluorobenzenesulfonate;[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium (PubChem CID 22057299) has the molecular formula C30H28F2O6S2 and a molecular weight of 586.68 g/mol. Its IUPAC name is 2,4-difluorobenzenesulfonate;[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium.
| Compound Name | 2,4-difluorobenzenesulfonate;[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 22057299 |
| Molecular Formula | C30H28F2O6S2 |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 586.13 |
| IUPAC Name | 2,4-difluorobenzenesulfonate;[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium |
| SMILES | CC(C)(C)OC(=O)COc1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=S(=O)([O-])c1ccc(F)cc1F |
| InChI | InChI=1S/C24H25O3S.C6H4F2O3S/c1-24(2,3)27-23(25)18-26-19-14-16-22(17-15-19)28(20-10-6-4-7-11-20)21-12-8-5-9-13-21;7-4-1-2-6(5(8)3-4)12(9,10)11/h4-17H,18H2,1-3H3;1-3H,(H,9,10,11)/q+1;/p-1 |
| InChIKey | BAUZFWSEPPIHTN-UHFFFAOYSA-M |
| XLogP | 6.37 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|